Hydroxy-PEG4-(CH2)2-Boc structure
|
Common Name | Hydroxy-PEG4-(CH2)2-Boc | ||
|---|---|---|---|---|
| CAS Number | 518044-32-1 | Molecular Weight | 322.39500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H30O7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Hydroxy-PEG4-(CH2)2-BocHydroxy-PEG4-(CH2)2-Boc is a uncleavable ADC linker used in the synthesis of antibody-drug conjugates (ADCs). Hydroxy-PEG4-(CH2)2-Boc is extracted from patent WO2004008101A2 (compound 191). |
| Name | tert-butyl 3-(2-{2-[2-(2-hydroxy-ethoxy)-ethoxy]-ethoxy}-ethoxy)propanoate |
|---|---|
| Synonym | More Synonyms |
| Description | Hydroxy-PEG4-(CH2)2-Boc is a uncleavable ADC linker used in the synthesis of antibody-drug conjugates (ADCs). Hydroxy-PEG4-(CH2)2-Boc is extracted from patent WO2004008101A2 (compound 191). |
|---|---|
| Related Catalog | |
| Target |
Non-cleavable |
| In Vitro | ADCs are comprised of an antibody to which is attached an ADC cytotoxin through an ADC linker. |
| References |
| Molecular Formula | C15H30O7 |
|---|---|
| Molecular Weight | 322.39500 |
| Exact Mass | 322.19900 |
| PSA | 83.45000 |
| LogP | 0.77690 |
| InChIKey | FJRDXEGYAVAMLB-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)CCOCCOCCOCCOCCO |
| tert-butyl 3-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethoxy]propanoate |
| tert-butyl 1-hydroxy-3,6,9,12-tetraoxapentadecan-15-oate |
| tert-butyl 15-hydroxy-4,7,10,13-tetraoxapentadecanoate |
| tert-butyl-15-hydroxy-4,7,10,13-tetraoxapentadecanoate |
| t-butyl 15-hydroxy-4,7,10,13-tetraoxapentadecanoate |
| 15-Hydroxy-4,7,10,13-tetraoxapentadecanoic acid tert-butyl ester |