caspase-8 inhibitor structure
|
Common Name | caspase-8 inhibitor | ||
|---|---|---|---|---|
| CAS Number | 191338-86-0 | Molecular Weight | 502.516 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 971.9±65.0 °C at 760 mmHg | |
| Molecular Formula | C21H34N4O10 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 541.6±34.3 °C | |
Use of caspase-8 inhibitorAc-?IETD-?CHO is a potent, reversible inhibitor of granzyme B and caspase-8. Ac-?IETD-?CHO inhibits Fas-mediated apoptotic cell death, hemorrhage, and liver failure. Ac-?IETD-?CHO also inhibits cytotoxic T lymphocytes induced cell death[1][2]. |
| Name | ac-ietd-cho |
|---|---|
| Synonym | More Synonyms |
| Description | Ac-?IETD-?CHO is a potent, reversible inhibitor of granzyme B and caspase-8. Ac-?IETD-?CHO inhibits Fas-mediated apoptotic cell death, hemorrhage, and liver failure. Ac-?IETD-?CHO also inhibits cytotoxic T lymphocytes induced cell death[1][2]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 971.9±65.0 °C at 760 mmHg |
| Molecular Formula | C21H34N4O10 |
| Molecular Weight | 502.516 |
| Flash Point | 541.6±34.3 °C |
| Exact Mass | 502.227478 |
| PSA | 228.30000 |
| LogP | -0.55 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
| Index of Refraction | 1.527 |
| InChIKey | AXTKTZHLZLOIIO-UHFFFAOYSA-N |
| SMILES | CCC(C)C(NC(C)=O)C(=O)NC(CCC(=O)O)C(=O)NC(C(=O)NC(C=O)CC(=O)O)C(C)O |
| WGK Germany | 3 |
|---|
| ac-ietd-aldehyde |
| L-Threoninamide, N-acetyl-L-isoleucyl-L-α-glutamyl-N-[(1S)-2-carboxy-1-formylethyl]- |
| granzyme b inhibitor (aldehyde) |
| ac-ile-glu-thr-asp-cho |
| N-Acetyl-L-isoleucyl-L-α-glutamyl-N-[(2S)-1-carboxy-3-oxo-2-propanyl]-L-threoninamide |
| ietd-cho,cell-permeable |
| ac-ile-glu-thr-asp-h (aldehyde) |
| granzyme b inhibitor ii |
| pase-8 inhibitor i |
| ac-ile-glu-thr-asp-aldehyde |
| pase 8 inhibitor 1 |