Azido-PEG2-VHL structure
|
Common Name | Azido-PEG2-VHL | ||
|---|---|---|---|---|
| CAS Number | 2597167-22-9 | Molecular Weight | 615.74 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C29H41N7O6S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Azido-PEG2-VHLAzido-PEG2-VHL is a multikinase degrader which can be used in the synthesis of PROTACs[1]. |
| Name | Azido-PEG2-VHL |
|---|
| Description | Azido-PEG2-VHL is a multikinase degrader which can be used in the synthesis of PROTACs[1]. |
|---|---|
| Related Catalog | |
| In Vitro | PROTACs contain two different ligands connected by a linker; one is a ligand for an E3 ubiquitin ligase and the other is for the target protein. PROTACs exploit the intracellular ubiquitin-proteasome system to selectively degrade target proteins[2]. |
| References |
[1]. STATSYUK A, et, al. Multikinase degraders. WO2021021797A1. |
| Molecular Formula | C29H41N7O6S |
|---|---|
| Molecular Weight | 615.74 |
| InChIKey | FXRBDYWHWCJFLA-UHFFFAOYSA-N |
| SMILES | Cc1ncsc1-c1ccc(CNC(=O)C2CC(O)CN2C(=O)C(NC(=O)CCOCCOCCN=[N+]=[N-])C(C)(C)C)cc1 |