m-PEG3-Tos structure
|
Common Name | m-PEG3-Tos | ||
|---|---|---|---|---|
| CAS Number | 62921-74-8 | Molecular Weight | 336.401 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H22O6S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 215 °C | |
Use of m-PEG3-Tosm-PEG3-Tos is a PEG-based PROTAC linker can be used in the synthesis of Silymarin (HY-W043277)[1]. |
| Name | 2-[2-(2-methoxyethoxy)ethoxy]ethanol,4-methylbenzenesulfonic acid |
|---|---|
| Synonym | More Synonyms |
| Description | m-PEG3-Tos is a PEG-based PROTAC linker can be used in the synthesis of Silymarin (HY-W043277)[1]. |
|---|---|
| Related Catalog | |
| Target |
PEGs |
| In Vitro | PROTACs contain two different ligands connected by a linker; one is a ligand for an E3 ubiquitin ligase and the other is for the target protein. PROTACs exploit the intracellular ubiquitin-proteasome system to selectively degrade target proteins. |
| References |
| Molecular Formula | C14H22O6S |
|---|---|
| Molecular Weight | 336.401 |
| Flash Point | 215 °C |
| Exact Mass | 336.124268 |
| PSA | 110.67000 |
| LogP | 1.98080 |
| Index of Refraction | 1.53 |
| InChIKey | IUDNRKGPFWUYIC-UHFFFAOYSA-N |
| SMILES | COCCOCCOCCOS(=O)(=O)c1ccc(C)cc1 |
| 3,6,9-trioxadecyl tosylate |
| 2-[2-(2-Methoxyethoxy)ethoxy]ethanol - 4-methylbenzenesulfonic acid (1:1) |
| CH3(OCH2CH2)3OTs |
| Ethanol, 2-[2-(2-methoxyethoxy)ethoxy]-, compd. with 4-methylbenzenesulfonic acid (1:1) |
| Ethanol,2-[2-(2-methoxyethoxy)ethoxy]-,4-methylbenzenesulfonate |
| CH3OC2H4OC2H4OC2H4OTs |
| 2-[2-(2-Methoxyethoxy)ethoxy]ethyl 4-methylbenzenesulfonate |
| triethyleneglycol monotosylate |
| triethylene glycol methyl tosyl ether |
| triethyleneglycol monomethyl ether tosylate |