Propargyl-PEG3-OCH2-Boc structure
|
Common Name | Propargyl-PEG3-OCH2-Boc | ||
|---|---|---|---|---|
| CAS Number | 888010-02-4 | Molecular Weight | 302.363 | |
| Density | 1.0±0.1 g/cm3 | Boiling Point | 365.6±32.0 °C at 760 mmHg | |
| Molecular Formula | C15H26O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 156.1±25.2 °C | |
Use of Propargyl-PEG3-OCH2-BocPropargyl-PEG3-OCH2-Boc is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
| Name | Propargyl-PEG4-CH2CO2tBu |
|---|---|
| Synonym | More Synonyms |
| Description | Propargyl-PEG3-OCH2-Boc is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
|---|---|
| Related Catalog | |
| Target |
PEGs Alkyl/ether |
| In Vitro | PROTACs contain two different ligands connected by a linker; one is a ligand for an E3 ubiquitin ligase and the other is for the target protein. PROTACs exploit the intracellular ubiquitin-proteasome system to selectively degrade target proteins[1]. |
| References |
| Density | 1.0±0.1 g/cm3 |
|---|---|
| Boiling Point | 365.6±32.0 °C at 760 mmHg |
| Molecular Formula | C15H26O6 |
| Molecular Weight | 302.363 |
| Flash Point | 156.1±25.2 °C |
| Exact Mass | 302.172943 |
| LogP | 1.02 |
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
| Index of Refraction | 1.453 |
| InChIKey | YWUOCZSOXBPJMP-UHFFFAOYSA-N |
| SMILES | C#CCOCCOCCOCCOCC(=O)OC(C)(C)C |
| PROPARGYL-PEG4-CH2COOTBU |