Mal-CO-PEG5-NHS ester structure
|
Common Name | Mal-CO-PEG5-NHS ester | ||
|---|---|---|---|---|
| CAS Number | 1232769-29-7 | Molecular Weight | 514.48 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C22H30N2O12 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Mal-CO-PEG5-NHS esterMal-CO-PEG5-NHS ester is a non-cleavable 5 unit PEG ADC linker used in the synthesis of antibody-drug conjugates (ADCs)[1]. |
| Name | Mal-CO-PEG5-NHS ester |
|---|
| Description | Mal-CO-PEG5-NHS ester is a non-cleavable 5 unit PEG ADC linker used in the synthesis of antibody-drug conjugates (ADCs)[1]. |
|---|---|
| Related Catalog | |
| Target |
Non-cleavable |
| In Vitro | ADCs are comprised of an antibody to which is attached an ADC cytotoxin through an ADC linker[1]. |
| References |
| Molecular Formula | C22H30N2O12 |
|---|---|
| Molecular Weight | 514.48 |
| InChIKey | NDZFOMRDWBBFNL-UHFFFAOYSA-N |
| SMILES | O=C(CCOCCOCCOCCOCCOCCC(=O)N1C(=O)C=CC1=O)ON1C(=O)CCC1=O |