1,14-Diazido-3,6,9,12-tetraoxatetradecane structure
|
Common Name | 1,14-Diazido-3,6,9,12-tetraoxatetradecane | ||
|---|---|---|---|---|
| CAS Number | 182760-73-2 | Molecular Weight | 288.30400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H20N6O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of 1,14-Diazido-3,6,9,12-tetraoxatetradecaneAzido-PEG4-azide is a PEG-based PROTAC linker can be used in the synthesis of PROTACs. |
| Name | 1-azido-2-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethoxy]ethane |
|---|---|
| Synonym | More Synonyms |
| Description | Azido-PEG4-azide is a PEG-based PROTAC linker can be used in the synthesis of PROTACs. |
|---|---|
| Related Catalog | |
| Target |
PEGs |
| In Vitro | PROTACs contain two different ligands connected by a linker; one is a ligand for an E3 ubiquitin ligase and the other is for the target protein. PROTACs exploit the intracellular ubiquitin-proteasome system to selectively degrade target proteins. |
| Molecular Formula | C10H20N6O4 |
|---|---|
| Molecular Weight | 288.30400 |
| Exact Mass | 288.15500 |
| PSA | 136.42000 |
| LogP | 0.57892 |
| InChIKey | QTEOEACEOUNLRG-UHFFFAOYSA-N |
| SMILES | [N-]=[N+]=NCCOCCOCCOCCOCCN=[N+]=[N-] |
| Hazard Codes | Xi |
|---|
| 1,14-diazido-3,6,9,12-tetraoxatetradecane |