m-PEG8-azide structure
|
Common Name | m-PEG8-azide | ||
|---|---|---|---|---|
| CAS Number | 869718-80-9 | Molecular Weight | 409.47500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H35N3O8 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of m-PEG8-azidem-PEG8-azide is a PEG-based PROTAC linker can be used in the synthesis of PROTACs. |
| Name | 25-azido-2,5,8,11,14,17,20,23-octaoxapentacosane |
|---|---|
| Synonym | More Synonyms |
| Description | m-PEG8-azide is a PEG-based PROTAC linker can be used in the synthesis of PROTACs. |
|---|---|
| Related Catalog | |
| In Vitro | PROTACs contain two different ligands connected by a linker; one is a ligand for an E3 ubiquitin ligase and the other is for the target protein. PROTACs exploit the intracellular ubiquitin-proteasome system to selectively degrade target proteins. |
| References |
| Molecular Formula | C17H35N3O8 |
|---|---|
| Molecular Weight | 409.47500 |
| Exact Mass | 409.24200 |
| PSA | 123.59000 |
| LogP | 0.51206 |
| Index of Refraction | 1.46 |
| InChIKey | ANQOCZRUHGJYCX-UHFFFAOYSA-N |
| SMILES | COCCOCCOCCOCCOCCOCCOCCOCCN=[N+]=[N-] |
| Precursor 0 | |
|---|---|
| DownStream 1 | |
| MFCD13184962 |