COX-2-IN-11 structure
|
Common Name | COX-2-IN-11 | ||
|---|---|---|---|---|
| CAS Number | 1023741-06-1 | Molecular Weight | 268.42 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H12OS3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of COX-2-IN-11COX-2-IN-11 (compound 7b2) is a potent and selective inhibitor of COX-2. COX-2-IN-11 has the potential for the research of inflammation diseases[1]. |
| Name | COX-2-IN-11 |
|---|
| Description | COX-2-IN-11 (compound 7b2) is a potent and selective inhibitor of COX-2. COX-2-IN-11 has the potential for the research of inflammation diseases[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C12H12OS3 |
|---|---|
| Molecular Weight | 268.42 |
| InChIKey | DVFIGGHRPAIQKO-UHFFFAOYSA-N |
| SMILES | COc1c(C)cc(-c2cc(=S)ss2)cc1C |