Azido-PEG5-acid structure
|
Common Name | Azido-PEG5-acid | ||
|---|---|---|---|---|
| CAS Number | 1425973-16-5 | Molecular Weight | 379.406 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H25N3O7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Azido-PEG5-acidAzido-PEG5-acid is a non-cleavable 5 unit PEG ADC linker used in the synthesis of antibody-drug conjugates (ADCs), such as the conjugate CPT-APO (CPT: Camptothecin (HY-16560)). |
| Name | Azido-PEG5-acid |
|---|---|
| Synonym | More Synonyms |
| Description | Azido-PEG5-acid is a non-cleavable 5 unit PEG ADC linker used in the synthesis of antibody-drug conjugates (ADCs), such as the conjugate CPT-APO (CPT: Camptothecin (HY-16560)). |
|---|---|
| Related Catalog | |
| Target |
Non-cleavable |
| In Vitro | ADCs are comprised of an antibody to which is attached an ADC cytotoxin through an ADC linker. |
| References |
| Molecular Formula | C13H25N3O7 |
|---|---|
| Molecular Weight | 379.406 |
| Exact Mass | 379.195465 |
| LogP | -1.78 |
| InChIKey | DPJUPQILWDVIKK-UHFFFAOYSA-N |
| SMILES | [N-]=[N+]=NCCOCCOCCOCCOCCOCCC(=O)O |
| Storage condition | 2-8°C |
| 1-Azido-3,6,9,12,15,18-hexaoxahenicosan-21-oic acid |
| 3,6,9,12,15,18-Hexaoxaheneicosan-21-oic acid, 1-azido- |
| MFCD22056306 |