VPC 23019 structure
|
Common Name | VPC 23019 | ||
|---|---|---|---|---|
| CAS Number | 449173-19-7 | Molecular Weight | 372.39600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H29N2O5P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of VPC 23019VPC23019, an aryl amide-containing Sphingosine 1-phosphate (S1P) analog, is a competitive antagonist at the S1P1 and S1P3 receptors (pKi= 7.86 and 5.93, respectively) and a agonist at the S1P4 and S1P5 receptors (pEC50= 6.58 and 7.07, respectively)[1]. |
| Name | N-(3-Octylphenyl)-O-phosphono-D-serinamide |
|---|
| Description | VPC23019, an aryl amide-containing Sphingosine 1-phosphate (S1P) analog, is a competitive antagonist at the S1P1 and S1P3 receptors (pKi= 7.86 and 5.93, respectively) and a agonist at the S1P4 and S1P5 receptors (pEC50= 6.58 and 7.07, respectively)[1]. |
|---|---|
| Related Catalog | |
| Target |
pKi: 7.86 (S1P1); 5.93 (S1P3). pEC50: 6.58 (S1P1); 7.07 (S1P3)[1] |
| References |
| Molecular Formula | C17H29N2O5P |
|---|---|
| Molecular Weight | 372.39600 |
| Exact Mass | 372.18100 |
| PSA | 135.18000 |
| LogP | 4.31450 |
| InChIKey | MRUSUGVVWGNKFE-MRXNPFEDSA-N |
| SMILES | CCCCCCCCc1cccc(NC(=O)C(N)COP(=O)(O)O)c1 |