Z-FA-FMK structure
|
Common Name | Z-FA-FMK | ||
|---|---|---|---|---|
| CAS Number | 105637-38-5 | Molecular Weight | 386.41700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C21H23FN2O4 | Melting Point | N/A | |
| MSDS | USA | Flash Point | N/A | |
Use of Z-FA-FMK(S,S)-Z-FA-FMK is a cell-permeable, irreversible cathepsin B inhibitor. (S,S)-Z-FA-FMK blocks LPS-induced production of IL-1α and IL-1β. (S,S)-Z-FA-FMK can be used as a negative control for caspase-1 and caspase-2 inhibitors because it lacks an aspartic acid residue at the P1 position[1][2]. |
| Name | z-fa-fmk |
|---|
| Description | (S,S)-Z-FA-FMK is a cell-permeable, irreversible cathepsin B inhibitor. (S,S)-Z-FA-FMK blocks LPS-induced production of IL-1α and IL-1β. (S,S)-Z-FA-FMK can be used as a negative control for caspase-1 and caspase-2 inhibitors because it lacks an aspartic acid residue at the P1 position[1][2]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C21H23FN2O4 |
|---|---|
| Molecular Weight | 386.41700 |
| Exact Mass | 386.16400 |
| PSA | 84.50000 |
| LogP | 3.34920 |
| InChIKey | ASXVEBPEZMSPHB-YJBOKZPZSA-N |
| SMILES | CC(NC(=O)C(Cc1ccccc1)NC(=O)OCc1ccccc1)C(=O)CF |