Thalidomide-NH-PEG2-C2-NH-Boc structure
|
Common Name | Thalidomide-NH-PEG2-C2-NH-Boc | ||
|---|---|---|---|---|
| CAS Number | 2097509-40-3 | Molecular Weight | 504.53 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C24H32N4O8 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Thalidomide-NH-PEG2-C2-NH-BocThalidomide-NH-PEG2-C2-NH-Boc is a synthesized E3 ligase ligand-linker conjugate that incorporates the Thalidomide based cereblon ligand and a PEG linker used for dBRD9 (compound 6) synthesis. dBRD9 is a selective BRD9 probe PROTAC degrader for the study of BAF complex biology[1]. |
| Name | Thalidomide-NH-PEG2-C2-NH-Boc |
|---|
| Description | Thalidomide-NH-PEG2-C2-NH-Boc is a synthesized E3 ligase ligand-linker conjugate that incorporates the Thalidomide based cereblon ligand and a PEG linker used for dBRD9 (compound 6) synthesis. dBRD9 is a selective BRD9 probe PROTAC degrader for the study of BAF complex biology[1]. |
|---|---|
| Related Catalog | |
| In Vitro | dBRD9 (0-1 μM) exerts a potent anti-proliferative effect, exceeding non-degrading probe potencies in excesses of 10 to 100 fold[1]. |
| References |
| Molecular Formula | C24H32N4O8 |
|---|---|
| Molecular Weight | 504.53 |
| InChIKey | YMOKYFTVZVHRSA-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NCCOCCOCCNc1cccc2c1C(=O)N(C1CCC(=O)NC1=O)C2=O |
| Hazard Codes | Xi |
|---|